Pyridine, 4-bromo-5-fluoro-2-methoxy-

Pyridine, 4-bromo-5-fluoro-2-methoxy- - Names and Identifiers

Name	4-bromo-5-fluoro-2-methoxy-pyridine
Synonyms	LogP 4-BROMO-5-FLUORO-2-METHOXYPYRIDINE 4-Bromo-5-fluoro-2-methoxypyridine 4-bromo-5-fluoro-2-methoxy-pyridine pyridine, 4-bromo-5-fluoro-2-methoxy- Pyridine, 4-bromo-5-fluoro-2-methoxy-
CAS	884495-00-5
InChI	InChI=1/C6H5BrFNO/c1-10-6-2-4(7)5(8)3-9-6/h2-3H,1H3

Pyridine, 4-bromo-5-fluoro-2-methoxy- - Physico-chemical Properties

Molecular Formula	C6H5BrFNO
Molar Mass	206.01
Density	1.621
Boling Point	201℃
Flash Point	75℃
Vapor Presure	0.453mmHg at 25°C
Storage Condition	under inert gas (nitrogen or Argon) at 2-8°C
Refractive Index	1.521

Pyridine, 4-bromo-5-fluoro-2-methoxy- - Introduction

The chemical formula is C6H5BrFNO. The following is a description of some of its properties, uses, methods and safety information:

Nature:
1. Appearance: colorless to light yellow solid.
2. melting point: about 70-73 ℃.
3. Boiling point: about 198-200 ℃.
4. Solubility: Slightly soluble in water, soluble in organic solvents such as methanol, ethanol and ether.
5. toxicity: with low acute toxicity.

Use:
1. as an organic synthesis intermediate: it can be used to synthesize various organic compounds, such as heterocyclic compounds, pharmaceutical intermediates, etc.
2. Reagent: In chemical laboratories, it can be used as a reagent for organic synthesis reactions.

Preparation Method:
The preparation of the ball can usually be carried out through the following steps:
1. Dissolve 4-bromo-5-fluoropyridine in methanol.
2. Add alkali (such as sodium hydroxide) and methyl iodide in methanol (bromine and fluorine in methanol need to be coupled with methyl iodide in the presence of alkali to generate the corresponding methyl esterification product).
3. The reaction is usually carried out at room temperature, and the reaction time is short, usually between a few hours and tens of hours.
4. After the reaction is completed, the reaction mixture is decomposed with water to extract the product.
5. The extracted product is refined, for example by crystallization.

Safety Information:
1. In normal use conditions, the impact on the human body and the environment is small. However, appropriate protective measures should still be taken, such as wearing appropriate protective gloves and glasses.
2. Avoid inhaling dust or gas, and avoid contact with skin and eyes.
3. Follow good laboratory safety practices when using and handling.
4. Keep away from fire and high temperature during storage and handling.
5. Follow relevant regulations and safety guidelines when handling this compound.

Last Update：2024-04-09 02:00:48